C24H27BN5O — CID 153455220
CID 153455220 (PubChem CID 153455220) has the molecular formula C24H27BN5O and a molecular weight of 412.33 g/mol.
| Compound Name | CID 153455220 |
|---|---|
| PubChem CID | 153455220 |
| Molecular Formula | C24H27BN5O |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | — |
| SMILES | CN(C)c1cccc(Nc2cc(-c3ccccc3)nc(C3CCCN([B]C=O)C3)n2)c1 |
| InChI | InChI=1S/C24H27BN5O/c1-29(2)21-12-6-11-20(14-21)26-23-15-22(18-8-4-3-5-9-18)27-24(28-23)19-10-7-13-30(16-19)25-17-31/h3-6,8-9,11-12,14-15,17,19H,7,10,13,16H2,1-2H3,(H,26,27,28) |
| InChIKey | XIMUKLBEDNEQSS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|