About 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole
2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole (PubChem CID 153455708) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole.
Analyze 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The IUPAC name of 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole (CID 153455708) is 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole.
What is the SMILES notation for 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The canonical SMILES for 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole is CC(C)(C)C1=NC2=C(CCC2)C1.
What is the InChIKey of 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The InChIKey is IIBSTTWYTABLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-11(2,3)10-7-8-5-4-6-9(8)12-10/h4-7H2,1-3H3.
What are the key properties of 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole has a molecular weight of 163.26 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole is sourced from PubChem (CID 153455708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).