C22H25N3O5 — CID 153457527
2-[2-[4-(3-tert-butylanilino)-6-hydroxyquinazolin-7-yl]oxyethoxy]acetic acid (PubChem CID 153457527) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[2-[4-(3-tert-butylanilino)-6-hydroxyquinazolin-7-yl]oxyethoxy]acetic acid.
| Compound Name | 2-[2-[4-(3-tert-butylanilino)-6-hydroxyquinazolin-7-yl]oxyethoxy]acetic acid |
|---|---|
| PubChem CID | 153457527 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[2-[4-(3-tert-butylanilino)-6-hydroxyquinazolin-7-yl]oxyethoxy]acetic acid |
| SMILES | CC(C)(C)c1cccc(Nc2ncnc3cc(OCCOCC(=O)O)c(O)cc23)c1 |
| InChI | InChI=1S/C22H25N3O5/c1-22(2,3)14-5-4-6-15(9-14)25-21-16-10-18(26)19(11-17(16)23-13-24-21)30-8-7-29-12-20(27)28/h4-6,9-11,13,26H,7-8,12H2,1-3H3,(H,27,28)(H,23,24,25) |
| InChIKey | FVQPZJWQXPARGA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|