C15H3F4I4O7S- — CID 153471599
2,3,5,6-tetrafluoro-4-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxybenzenesulfonate (PubChem CID 153471599) has the molecular formula C15H3F4I4O7S- and a molecular weight of 910.86 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471599 |
| Molecular Formula | C15H3F4I4O7S- |
| Molecular Weight | 910.86 g/mol |
| Exact Mass | 910.57 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxybenzenesulfonate |
| SMILES | COC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C15H4F4I4O7S/c1-29-14(24)2-3(9(21)11(23)10(22)8(2)20)15(25)30-12-4(16)6(18)13(31(26,27)28)7(19)5(12)17/h1H3,(H,26,27,28)/p-1 |
| InChIKey | NMAICMREEACRSQ-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|