C16H5F4I4O7S- — CID 153471615
4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153471615) has the molecular formula C16H5F4I4O7S- and a molecular weight of 924.88 g/mol. Its IUPAC name is 4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153471615 |
| Molecular Formula | C16H5F4I4O7S- |
| Molecular Weight | 924.88 g/mol |
| Exact Mass | 924.59 |
| IUPAC Name | 4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCOC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C16H6F4I4O7S/c1-2-30-15(25)3-4(10(22)12(24)11(23)9(3)21)16(26)31-13-5(17)7(19)14(32(27,28)29)8(20)6(13)18/h2H2,1H3,(H,27,28,29)/p-1 |
| InChIKey | XABNYSJAMXCHSO-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|