C19H9F4I4O8S- — CID 153471580
2,3,5,6-tetrafluoro-4-[2,3,4,5-tetraiodo-6-[(2-methyloxetan-2-yl)methoxycarbonyl]benzoyl]oxybenzenesulfonate (PubChem CID 153471580) has the molecular formula C19H9F4I4O8S- and a molecular weight of 980.95 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,3,4,5-tetraiodo-6-[(2-methyloxetan-2-yl)methoxycarbonyl]benzoyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,3,4,5-tetraiodo-6-[(2-methyloxetan-2-yl)methoxycarbonyl]benzoyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471580 |
| Molecular Formula | C19H9F4I4O8S- |
| Molecular Weight | 980.95 g/mol |
| Exact Mass | 980.61 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,3,4,5-tetraiodo-6-[(2-methyloxetan-2-yl)methoxycarbonyl]benzoyl]oxybenzenesulfonate |
| SMILES | CC1(COC(=O)c2c(I)c(I)c(I)c(I)c2C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)CCO1 |
| InChI | InChI=1S/C19H10F4I4O8S/c1-19(2-3-34-19)4-33-17(28)5-6(12(25)14(27)13(26)11(5)24)18(29)35-15-7(20)9(22)16(36(30,31)32)10(23)8(15)21/h2-4H2,1H3,(H,30,31,32)/p-1 |
| InChIKey | YANWQRUXRPFHCL-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.95 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|