C16H3F4I4O9S- — CID 153471682
4-[2-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153471682) has the molecular formula C16H3F4I4O9S- and a molecular weight of 954.87 g/mol. Its IUPAC name is 4-[2-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153471682 |
| Molecular Formula | C16H3F4I4O9S- |
| Molecular Weight | 954.87 g/mol |
| Exact Mass | 954.56 |
| IUPAC Name | 4-[2-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(COC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C16H4F4I4O9S/c17-5-7(19)14(34(29,30)31)8(20)6(18)13(5)33-2(25)1-32-16(28)4-3(15(26)27)9(21)11(23)12(24)10(4)22/h1H2,(H,26,27)(H,29,30,31)/p-1 |
| InChIKey | AZUYYQJVDKGGMQ-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 147.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|