C14HF4I4O7S- — CID 153471662
4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153471662) has the molecular formula C14HF4I4O7S- and a molecular weight of 896.83 g/mol. Its IUPAC name is 4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153471662 |
| Molecular Formula | C14HF4I4O7S- |
| Molecular Weight | 896.83 g/mol |
| Exact Mass | 896.56 |
| IUPAC Name | 4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(O)c1c(I)c(I)c(I)c(I)c1C(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C14H2F4I4O7S/c15-3-5(17)12(30(26,27)28)6(18)4(16)11(3)29-14(25)2-1(13(23)24)7(19)9(21)10(22)8(2)20/h(H,23,24)(H,26,27,28)/p-1 |
| InChIKey | WQGVNLLRGAJOQQ-UHFFFAOYSA-M |
| XLogP | 4.48 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.83 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|