C11H7I4O7S- — CID 153471761
2-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxyethanesulfonate (PubChem CID 153471761) has the molecular formula C11H7I4O7S- and a molecular weight of 790.85 g/mol. Its IUPAC name is 2-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxyethanesulfonate.
| Compound Name | 2-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 153471761 |
| Molecular Formula | C11H7I4O7S- |
| Molecular Weight | 790.85 g/mol |
| Exact Mass | 790.61 |
| IUPAC Name | 2-(2,3,4,5-tetraiodo-6-methoxycarbonylbenzoyl)oxyethanesulfonate |
| SMILES | COC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H8I4O7S/c1-21-10(16)4-5(7(13)9(15)8(14)6(4)12)11(17)22-2-3-23(18,19)20/h2-3H2,1H3,(H,18,19,20)/p-1 |
| InChIKey | DZRDVYQLNHJYER-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|