C11H9I4NO5S — CID 147514480
ethyl 2,3,4,5-tetraiodo-6-(methylsulfonylcarbamoyl)benzoate (PubChem CID 147514480) has the molecular formula C11H9I4NO5S and a molecular weight of 774.88 g/mol. Its IUPAC name is ethyl 2,3,4,5-tetraiodo-6-(methylsulfonylcarbamoyl)benzoate.
| Compound Name | ethyl 2,3,4,5-tetraiodo-6-(methylsulfonylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 147514480 |
| Molecular Formula | C11H9I4NO5S |
| Molecular Weight | 774.88 g/mol |
| Exact Mass | 774.64 |
| IUPAC Name | ethyl 2,3,4,5-tetraiodo-6-(methylsulfonylcarbamoyl)benzoate |
| SMILES | CCOC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C11H9I4NO5S/c1-3-21-11(18)5-4(10(17)16-22(2,19)20)6(12)8(14)9(15)7(5)13/h3H2,1-2H3,(H,16,17) |
| InChIKey | FJYOAHGNMGEZJV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|