C12H9I4O7S- — CID 153471768
2-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxyethanesulfonate (PubChem CID 153471768) has the molecular formula C12H9I4O7S- and a molecular weight of 804.88 g/mol. Its IUPAC name is 2-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxyethanesulfonate.
| Compound Name | 2-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 153471768 |
| Molecular Formula | C12H9I4O7S- |
| Molecular Weight | 804.88 g/mol |
| Exact Mass | 804.63 |
| IUPAC Name | 2-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxyethanesulfonate |
| SMILES | CCOC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H10I4O7S/c1-2-22-11(17)5-6(8(14)10(16)9(15)7(5)13)12(18)23-3-4-24(19,20)21/h2-4H2,1H3,(H,19,20,21)/p-1 |
| InChIKey | KTIVXWLEPNBOGU-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|