C48H88O2Si — CID 153487351
bis[(4R)-6-tert-butyl-4-(3,5-dimethylcyclohexyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 153487351) has the molecular formula C48H88O2Si and a molecular weight of 725.32 g/mol. Its IUPAC name is bis[(4R)-6-tert-butyl-4-(3,5-dimethylcyclohexyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[(4R)-6-tert-butyl-4-(3,5-dimethylcyclohexyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 153487351 |
| Molecular Formula | C48H88O2Si |
| Molecular Weight | 725.32 g/mol |
| Exact Mass | 724.66 |
| IUPAC Name | bis[(4R)-6-tert-butyl-4-(3,5-dimethylcyclohexyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | COC1C(C(C)(C)C)CC2C(CC(C)C2[Si](C)(C)C2C(C)CC3C2CC(C(C)(C)C)C(OC)[C@@H]3C2CC(C)CC(C)C2)[C@H]1C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C48H88O2Si/c1-27-17-28(2)20-33(19-27)41-35-23-31(5)45(37(35)25-39(43(41)49-13)47(7,8)9)51(15,16)46-32(6)24-36-38(46)26-40(48(10,11)12)44(50-14)42(36)34-21-29(3)18-30(4)22-34/h27-46H,17-26H2,1-16H3/t27?,28?,29?,30?,31?,32?,33?,34?,35?,36?,37?,38?,39?,40?,41-,42-,43?,44?,45?,46?/m1/s1 |
| InChIKey | UXVBHEZYWSAJIU-SIKQRPPDSA-N |
| XLogP | 13.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.32 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|