C16H18I2O2Si — CID 153491530
(3,5-diiodophenyl)-diethoxy-phenylsilane (PubChem CID 153491530) has the molecular formula C16H18I2O2Si and a molecular weight of 524.21 g/mol. Its IUPAC name is (3,5-diiodophenyl)-diethoxy-phenylsilane.
| Compound Name | (3,5-diiodophenyl)-diethoxy-phenylsilane |
|---|---|
| PubChem CID | 153491530 |
| Molecular Formula | C16H18I2O2Si |
| Molecular Weight | 524.21 g/mol |
| Exact Mass | 523.92 |
| IUPAC Name | (3,5-diiodophenyl)-diethoxy-phenylsilane |
| SMILES | CCO[Si](OCC)(c1ccccc1)c1cc(I)cc(I)c1 |
| InChI | InChI=1S/C16H18I2O2Si/c1-3-19-21(20-4-2,15-8-6-5-7-9-15)16-11-13(17)10-14(18)12-16/h5-12H,3-4H2,1-2H3 |
| InChIKey | NUAIIDIFPRBHMI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|