C21H24O2Se — CID 15349188
(4R,5S,6S)-4-phenyl-6-(phenylselanylmethyl)-5-propan-2-yloxan-2-one (PubChem CID 15349188) has the molecular formula C21H24O2Se and a molecular weight of 387.38 g/mol. Its IUPAC name is (4R,5S,6S)-4-phenyl-6-(phenylselanylmethyl)-5-propan-2-yloxan-2-one.
| Compound Name | (4R,5S,6S)-4-phenyl-6-(phenylselanylmethyl)-5-propan-2-yloxan-2-one |
|---|---|
| PubChem CID | 15349188 |
| Molecular Formula | C21H24O2Se |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (4R,5S,6S)-4-phenyl-6-(phenylselanylmethyl)-5-propan-2-yloxan-2-one |
| SMILES | CC(C)[C@@H]1[C@@H](C[Se]c2ccccc2)OC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24O2Se/c1-15(2)21-18(16-9-5-3-6-10-16)13-20(22)23-19(21)14-24-17-11-7-4-8-12-17/h3-12,15,18-19,21H,13-14H2,1-2H3/t18-,19+,21-/m0/s1 |
| InChIKey | SAGQQBGBIVRCFO-ZVDOUQERSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|