C27H24FIN2O3 — CID 153492086
8-[(3-aminophenyl)methyl]-6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione (PubChem CID 153492086) has the molecular formula C27H24FIN2O3 and a molecular weight of 570.40 g/mol. Its IUPAC name is 8-[(3-aminophenyl)methyl]-6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 8-[(3-aminophenyl)methyl]-6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 153492086 |
| Molecular Formula | C27H24FIN2O3 |
| Molecular Weight | 570.40 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 8-[(3-aminophenyl)methyl]-6-cyclopropyl-4-[(2-fluoro-4-iodophenyl)methyl]-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1c(Cc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(C)c(Cc3cccc(N)c3)c2oc1=O |
| InChI | InChI=1S/C27H24FIN2O3/c1-14-21(12-17-6-7-18(29)13-23(17)28)24-25(34-27(14)33)22(11-16-4-3-5-19(30)10-16)15(2)31(26(24)32)20-8-9-20/h3-7,10,13,20H,8-9,11-12,30H2,1-2H3 |
| InChIKey | JJIZEIDSCVBTGE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|