C9H19N2O+ — CID 153498626
5-acetamido(3,4,5-13C3)pentylidene(dimethyl)azanium (PubChem CID 153498626) has the molecular formula C9H19N2O+ and a molecular weight of 174.24 g/mol. Its IUPAC name is 5-acetamido(3,4,5-13C3)pentylidene(dimethyl)azanium.
| Compound Name | 5-acetamido(3,4,5-13C3)pentylidene(dimethyl)azanium |
|---|---|
| PubChem CID | 153498626 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 5-acetamido(3,4,5-13C3)pentylidene(dimethyl)azanium |
| SMILES | CC(=O)N[13CH2][13CH2][13CH2]CC=[N+](C)C |
| InChI | InChI=1S/C9H18N2O/c1-9(12)10-7-5-4-6-8-11(2)3/h8H,4-7H2,1-3H3/p+1/i4+1,5+1,7+1 |
| InChIKey | BMIFCDLDYUQBKO-WXOWWYAKSA-O |
| XLogP | 0.64 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|