About 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one
8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one (PubChem CID 15358575) has the molecular formula C12H10OS
and a molecular weight of 202.28 g/mol. Its IUPAC name is 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one.
Analyze 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one?
The IUPAC name of 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one (CID 15358575) is 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one.
What is the SMILES notation for 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one?
The canonical SMILES for 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one is O=C1CCC23c4ccccc4SC2C13.
What is the InChIKey of 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one?
The InChIKey is VQXKASJJEGNBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OS/c13-8-5-6-12-7-3-1-2-4-9(7)14-11(12)10(8)12/h1-4,10-11H,5-6H2.
What are the key properties of 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one?
8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one has a molecular weight of 202.28 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-thiatetracyclo[7.4.0.01,10.02,7]trideca-2,4,6-trien-11-one is sourced from PubChem (CID 15358575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).