C20H22F2N6O2 — CID 15366661
4-[9-[(2,3-difluorophenyl)methyl]-2-morpholin-4-ylpurin-6-yl]morpholine (PubChem CID 15366661) has the molecular formula C20H22F2N6O2 and a molecular weight of 416.43 g/mol. Its IUPAC name is 4-[9-[(2,3-difluorophenyl)methyl]-2-morpholin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[9-[(2,3-difluorophenyl)methyl]-2-morpholin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 15366661 |
| Molecular Formula | C20H22F2N6O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-[9-[(2,3-difluorophenyl)methyl]-2-morpholin-4-ylpurin-6-yl]morpholine |
| SMILES | Fc1cccc(Cn2cnc3c(N4CCOCC4)nc(N4CCOCC4)nc32)c1F |
| InChI | InChI=1S/C20H22F2N6O2/c21-15-3-1-2-14(16(15)22)12-28-13-23-17-18(26-4-8-29-9-5-26)24-20(25-19(17)28)27-6-10-30-11-7-27/h1-3,13H,4-12H2 |
| InChIKey | NQWVUHPXYJJJDI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |