C24H32O3 — CID 15370327
3,5-bis(1-adamantyl)-5-hydroxyfuran-2-one (PubChem CID 15370327) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3,5-bis(1-adamantyl)-5-hydroxyfuran-2-one.
| Compound Name | 3,5-bis(1-adamantyl)-5-hydroxyfuran-2-one |
|---|---|
| PubChem CID | 15370327 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 3,5-bis(1-adamantyl)-5-hydroxyfuran-2-one |
| SMILES | O=C1OC(O)(C23CC4CC(CC(C4)C2)C3)C=C1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32O3/c25-21-20(22-7-14-1-15(8-22)3-16(2-14)9-22)13-24(26,27-21)23-10-17-4-18(11-23)6-19(5-17)12-23/h13-19,26H,1-12H2 |
| InChIKey | MDSCQIOWJXQFIR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |