C32H52N6O4 — CID 15390921
1,7-bis[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methylpurine-2,6-dione (PubChem CID 15390921) has the molecular formula C32H52N6O4 and a molecular weight of 584.81 g/mol. Its IUPAC name is 1,7-bis[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methylpurine-2,6-dione.
| Compound Name | 1,7-bis[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 15390921 |
| Molecular Formula | C32H52N6O4 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | 1,7-bis[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methylpurine-2,6-dione |
| SMILES | CCN(CC)CC#CC(C)(O)CCCCn1c(=O)c2c(ncn2CCCCC(C)(O)C#CCN(CC)CC)n(C)c1=O |
| InChI | InChI=1S/C32H52N6O4/c1-8-35(9-2)22-16-20-31(5,41)18-12-14-24-37-26-33-28-27(37)29(39)38(30(40)34(28)7)25-15-13-19-32(6,42)21-17-23-36(10-3)11-4/h26,41-42H,8-15,18-19,22-25H2,1-7H3 |
| InChIKey | UQOAVGNCQUWPBG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|