C22H35N5O3 — CID 15390920
7-[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methyl-1-propylpurine-2,6-dione (PubChem CID 15390920) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 7-[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methyl-1-propylpurine-2,6-dione.
| Compound Name | 7-[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methyl-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 15390920 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 7-[8-(diethylamino)-5-hydroxy-5-methyloct-6-ynyl]-3-methyl-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(ncn2CCCCC(C)(O)C#CCN(CC)CC)n(C)c1=O |
| InChI | InChI=1S/C22H35N5O3/c1-6-14-27-20(28)18-19(24(5)21(27)29)23-17-26(18)16-10-9-12-22(4,30)13-11-15-25(7-2)8-3/h17,30H,6-10,12,14-16H2,1-5H3 |
| InChIKey | QVGWEVYXNIRJSU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|