C16H17NOS — CID 15395310
(5R)-5-benzyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide (PubChem CID 15395310) has the molecular formula C16H17NOS and a molecular weight of 271.39 g/mol. Its IUPAC name is (5R)-5-benzyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide.
| Compound Name | (5R)-5-benzyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide |
|---|---|
| PubChem CID | 15395310 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (5R)-5-benzyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide |
| SMILES | O=S1(c2ccccc2)=NCC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H17NOS/c18-19(15-9-5-2-6-10-15)16(11-12-17-19)13-14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-,19?/m0/s1 |
| InChIKey | FXIDLMKUGDOBRO-UCFFOFKASA-N |
| XLogP | 3.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |