C11H16F3NO3 — CID 15396774
6-butoxy-7a-(trifluoromethyl)-3a,4,5,6-tetrahydropyrano[3,2-d][1,2]oxazole (PubChem CID 15396774) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is 6-butoxy-7a-(trifluoromethyl)-3a,4,5,6-tetrahydropyrano[3,2-d][1,2]oxazole.
| Compound Name | 6-butoxy-7a-(trifluoromethyl)-3a,4,5,6-tetrahydropyrano[3,2-d][1,2]oxazole |
|---|---|
| PubChem CID | 15396774 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 6-butoxy-7a-(trifluoromethyl)-3a,4,5,6-tetrahydropyrano[3,2-d][1,2]oxazole |
| SMILES | CCCCOC1CCC2C=NOC2(C(F)(F)F)O1 |
| InChI | InChI=1S/C11H16F3NO3/c1-2-3-6-16-9-5-4-8-7-15-18-10(8,17-9)11(12,13)14/h7-9H,2-6H2,1H3 |
| InChIKey | AKBQWHMQZQUHOX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|