C44H86OS4 — CID 154021840
2-ethyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol (PubChem CID 154021840) has the molecular formula C44H86OS4 and a molecular weight of 759.44 g/mol. Its IUPAC name is 2-ethyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol.
| Compound Name | 2-ethyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 154021840 |
| Molecular Formula | C44H86OS4 |
| Molecular Weight | 759.44 g/mol |
| Exact Mass | 758.56 |
| IUPAC Name | 2-ethyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol |
| SMILES | CCCCCCCCSCC1(CSCCCCCCCC)C=C(CC)C(O)C(CSCCCCCCCC)(CSCCCCCCCC)C1 |
| InChI | InChI=1S/C44H86OS4/c1-6-11-15-19-23-27-31-46-37-43(38-47-32-28-24-20-16-12-7-2)35-41(10-5)42(45)44(36-43,39-48-33-29-25-21-17-13-8-3)40-49-34-30-26-22-18-14-9-4/h35,42,45H,6-34,36-40H2,1-5H3 |
| InChIKey | BGJPGBPZWBWDDT-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.44 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|