C9H8F3NO — CID 154023698
3-deuterio-3-(2,4-dideuterio-3,5,6-trifluorophenoxy)azetidine (PubChem CID 154023698) has the molecular formula C9H8F3NO and a molecular weight of 206.18 g/mol. Its IUPAC name is 3-deuterio-3-(2,4-dideuterio-3,5,6-trifluorophenoxy)azetidine.
| Compound Name | 3-deuterio-3-(2,4-dideuterio-3,5,6-trifluorophenoxy)azetidine |
|---|---|
| PubChem CID | 154023698 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-deuterio-3-(2,4-dideuterio-3,5,6-trifluorophenoxy)azetidine |
| SMILES | [2H]c1c(F)c([2H])c(OC2([2H])CNC2)c(F)c1F |
| InChI | InChI=1S/C9H8F3NO/c10-5-1-7(11)9(12)8(2-5)14-6-3-13-4-6/h1-2,6,13H,3-4H2/i1D,2D,6D |
| InChIKey | GTBDBFIFWULFCC-AQIZJVGCSA-N |
| XLogP | 1.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|