C11H16O4 — CID 15402415
(3R,6S)-3-ethyl-1,7-dioxaspiro[5.5]undecane-2,8-dione (PubChem CID 15402415) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3R,6S)-3-ethyl-1,7-dioxaspiro[5.5]undecane-2,8-dione.
| Compound Name | (3R,6S)-3-ethyl-1,7-dioxaspiro[5.5]undecane-2,8-dione |
|---|---|
| PubChem CID | 15402415 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3R,6S)-3-ethyl-1,7-dioxaspiro[5.5]undecane-2,8-dione |
| SMILES | CC[C@@H]1CC[C@]2(CCCC(=O)O2)OC1=O |
| InChI | InChI=1S/C11H16O4/c1-2-8-5-7-11(15-10(8)13)6-3-4-9(12)14-11/h8H,2-7H2,1H3/t8-,11+/m1/s1 |
| InChIKey | OIIXVPYSKRUANL-KCJUWKMLSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |