C17H16N4O2Se — CID 154034077
[1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamic acid (PubChem CID 154034077) has the molecular formula C17H16N4O2Se and a molecular weight of 387.30 g/mol. Its IUPAC name is [1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamic acid.
| Compound Name | [1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamic acid |
|---|---|
| PubChem CID | 154034077 |
| Molecular Formula | C17H16N4O2Se |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | [1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamic acid |
| SMILES | O=C(O)NC(Cc1ccccc1)c1nnc(Nc2ccccc2)[se]1 |
| InChI | InChI=1S/C17H16N4O2Se/c22-17(23)19-14(11-12-7-3-1-4-8-12)15-20-21-16(24-15)18-13-9-5-2-6-10-13/h1-10,14,19H,11H2,(H,18,21)(H,22,23) |
| InChIKey | CCADNAPTIHNKMQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|