C21H24N4O2Se — CID 156672957
tert-butyl N-[1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamate (PubChem CID 156672957) has the molecular formula C21H24N4O2Se and a molecular weight of 443.41 g/mol. Its IUPAC name is tert-butyl N-[1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 156672957 |
| Molecular Formula | C21H24N4O2Se |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | tert-butyl N-[1-(5-anilino-1,3,4-selenadiazol-2-yl)-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)c1nnc(Nc2ccccc2)[se]1 |
| InChI | InChI=1S/C21H24N4O2Se/c1-21(2,3)27-20(26)23-17(14-15-10-6-4-7-11-15)18-24-25-19(28-18)22-16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | IRRFWULQMYDMQN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|