C25H28ClN5O3 — CID 154035627
(1S,2S,3R,4R)-3-[[5-chloro-2-[(1,5,5-trimethyl-2-oxo-3,4-dihydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 154035627) has the molecular formula C25H28ClN5O3 and a molecular weight of 481.98 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-chloro-2-[(1,5,5-trimethyl-2-oxo-3,4-dihydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[(1,5,5-trimethyl-2-oxo-3,4-dihydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154035627 |
| Molecular Formula | C25H28ClN5O3 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[(1,5,5-trimethyl-2-oxo-3,4-dihydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CN1C(=O)CCC(C)(C)c2cc(Nc3ncc(Cl)c(N[C@H]4[C@@H](C(=O)O)[C@@H]5C=C[C@H]4C5)n3)ccc21 |
| InChI | InChI=1S/C25H28ClN5O3/c1-25(2)9-8-19(32)31(3)18-7-6-15(11-16(18)25)28-24-27-12-17(26)22(30-24)29-21-14-5-4-13(10-14)20(21)23(33)34/h4-7,11-14,20-21H,8-10H2,1-3H3,(H,33,34)(H2,27,28,29,30)/t13-,14+,20+,21-/m1/s1 |
| InChIKey | SZEQXZDYAAIJQA-VKTIVEEGSA-N |
| XLogP | 4.59 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|