C23H25ClN6O4 — CID 154035595
(1S,2S,3R,4R)-3-[[5-chloro-2-[(7-methoxy-1-methyl-2-oxo-4,5-dihydro-3H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 154035595) has the molecular formula C23H25ClN6O4 and a molecular weight of 484.94 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-chloro-2-[(7-methoxy-1-methyl-2-oxo-4,5-dihydro-3H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[(7-methoxy-1-methyl-2-oxo-4,5-dihydro-3H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154035595 |
| Molecular Formula | C23H25ClN6O4 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[(7-methoxy-1-methyl-2-oxo-4,5-dihydro-3H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(N[C@H]3[C@@H](C(=O)O)[C@@H]4C=C[C@H]3C4)n1)N(C)C(=O)CNC2 |
| InChI | InChI=1S/C23H25ClN6O4/c1-30-16-7-15(17(34-2)6-13(16)8-25-10-18(30)31)27-23-26-9-14(24)21(29-23)28-20-12-4-3-11(5-12)19(20)22(32)33/h3-4,6-7,9,11-12,19-20,25H,5,8,10H2,1-2H3,(H,32,33)(H2,26,27,28,29)/t11-,12+,19+,20-/m1/s1 |
| InChIKey | GXXKTYRYLHWWDS-RWLOKEPNSA-N |
| XLogP | 2.64 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|