C27H34ClN5O3 — CID 129111150
(1S,2S,3R,4R)-3-[[5-chloro-2-[[1-(2-methoxyethyl)-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 129111150) has the molecular formula C27H34ClN5O3 and a molecular weight of 512.05 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-chloro-2-[[1-(2-methoxyethyl)-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[[1-(2-methoxyethyl)-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 129111150 |
| Molecular Formula | C27H34ClN5O3 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[[1-(2-methoxyethyl)-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COCCN1CCCC(C)(C)c2ccc(Nc3ncc(Cl)c(N[C@H]4[C@@H](C(=O)O)[C@@H]5C=C[C@H]4C5)n3)cc21 |
| InChI | InChI=1S/C27H34ClN5O3/c1-27(2)9-4-10-33(11-12-36-3)21-14-18(7-8-19(21)27)30-26-29-15-20(28)24(32-26)31-23-17-6-5-16(13-17)22(23)25(34)35/h5-8,14-17,22-23H,4,9-13H2,1-3H3,(H,34,35)(H2,29,30,31,32)/t16-,17+,22+,23-/m1/s1 |
| InChIKey | FWFGYMPUDQRXCL-YHFSLCLQSA-N |
| XLogP | 5.09 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|