C30H40ClN7O2 — CID 118273032
[(1S,2S,3R,4R)-3-[[5-chloro-2-[[5,5-dimethyl-1-(2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate (PubChem CID 118273032) has the molecular formula C30H40ClN7O2 and a molecular weight of 566.15 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[[5-chloro-2-[[5,5-dimethyl-1-(2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate.
| Compound Name | [(1S,2S,3R,4R)-3-[[5-chloro-2-[[5,5-dimethyl-1-(2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
|---|---|
| PubChem CID | 118273032 |
| Molecular Formula | C30H40ClN7O2 |
| Molecular Weight | 566.15 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[[5-chloro-2-[[5,5-dimethyl-1-(2-pyrrolidin-1-ylethyl)-3,4-dihydro-2H-1-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
| SMILES | CC1(C)CCCN(CCN2CCCC2)c2cc(Nc3ncc(Cl)c(N[C@H]4[C@@H](OC(N)=O)[C@@H]5C=C[C@H]4C5)n3)ccc21 |
| InChI | InChI=1S/C30H40ClN7O2/c1-30(2)10-5-13-38(15-14-37-11-3-4-12-37)24-17-21(8-9-22(24)30)34-29-33-18-23(31)27(36-29)35-25-19-6-7-20(16-19)26(25)40-28(32)39/h6-9,17-20,25-26H,3-5,10-16H2,1-2H3,(H2,32,39)(H2,33,34,35,36)/t19-,20+,25+,26-/m0/s1 |
| InChIKey | QRJXXYYJAWBTRC-XJQCFKMBSA-N |
| XLogP | 5.30 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.15 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|