C18H24N8O2S2 — CID 154054051
(2S)-N'-ethylsulfonyl-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 154054051) has the molecular formula C18H24N8O2S2 and a molecular weight of 448.58 g/mol. Its IUPAC name is (2S)-N'-ethylsulfonyl-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | (2S)-N'-ethylsulfonyl-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 154054051 |
| Molecular Formula | C18H24N8O2S2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (2S)-N'-ethylsulfonyl-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)N=C(Nc1nccs1)N1CCN(c2ncnc3[nH]cc(C)c23)C[C@@H]1C |
| InChI | InChI=1S/C18H24N8O2S2/c1-4-30(27,28)24-17(23-18-19-5-8-29-18)26-7-6-25(10-13(26)3)16-14-12(2)9-20-15(14)21-11-22-16/h5,8-9,11,13H,4,6-7,10H2,1-3H3,(H,19,23,24)(H,20,21,22)/t13-/m0/s1 |
| InChIKey | IKDWTFYMCNLZST-ZDUSSCGKSA-N |
| XLogP | 2.05 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|