C20H21FN8 — CID 74402502
N-cyano-N'-(4-fluorophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide (PubChem CID 74402502) has the molecular formula C20H21FN8 and a molecular weight of 392.44 g/mol. Its IUPAC name is N-cyano-N'-(4-fluorophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide.
| Compound Name | N-cyano-N'-(4-fluorophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 74402502 |
| Molecular Formula | C20H21FN8 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-cyano-N'-(4-fluorophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/c4ccc(F)cc4)NC#N)C(C)C3)c12 |
| InChI | InChI=1S/C20H21FN8/c1-13-9-23-18-17(13)19(26-12-25-18)28-7-8-29(14(2)10-28)20(24-11-22)27-16-5-3-15(21)4-6-16/h3-6,9,12,14H,7-8,10H2,1-2H3,(H,24,27)(H,23,25,26) |
| InChIKey | ASSZLITWUHANSD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|