C25H28O4 — CID 154085051
phenyl-[(8R,9S,13S,14S)-3,4,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanone (PubChem CID 154085051) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is phenyl-[(8R,9S,13S,14S)-3,4,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanone.
| Compound Name | phenyl-[(8R,9S,13S,14S)-3,4,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanone |
|---|---|
| PubChem CID | 154085051 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | phenyl-[(8R,9S,13S,14S)-3,4,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanone |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)c(O)c4CC[C@H]3[C@@H]1CCC2(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O4/c1-24-13-11-17-16-9-10-21(26)22(27)19(16)8-7-18(17)20(24)12-14-25(24,29)23(28)15-5-3-2-4-6-15/h2-6,9-10,17-18,20,26-27,29H,7-8,11-14H2,1H3/t17-,18-,20+,24+,25?/m1/s1 |
| InChIKey | ABRKGKFHCKUPAK-RQRSXAAPSA-N |
| XLogP | 4.57 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|