C24H23F3N2O2 — CID 154095800
(1S,3aR,5R,6R,7aR)-5,6-difluoro-1-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-1,3-oxazolidine]-2'-one (PubChem CID 154095800) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is (1S,3aR,5R,6R,7aR)-5,6-difluoro-1-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-1,3-oxazolidine]-2'-one.
| Compound Name | (1S,3aR,5R,6R,7aR)-5,6-difluoro-1-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-1,3-oxazolidine]-2'-one |
|---|---|
| PubChem CID | 154095800 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (1S,3aR,5R,6R,7aR)-5,6-difluoro-1-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-1,3-oxazolidine]-2'-one |
| SMILES | O=C1NCC2(C[C@@H]3C[C@@H](F)[C@H](F)C[C@H]3[C@@H]2C=Cc2ccc(-c3cccc(F)c3)cn2)O1 |
| InChI | InChI=1S/C24H23F3N2O2/c25-17-3-1-2-14(8-17)15-4-5-18(28-12-15)6-7-20-19-10-22(27)21(26)9-16(19)11-24(20)13-29-23(30)31-24/h1-8,12,16,19-22H,9-11,13H2,(H,29,30)/t16-,19+,20-,21+,22+,24?/m0/s1 |
| InChIKey | VGWWHDSYFOIDCJ-JPQPNBBISA-N |
| XLogP | 5.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |