C24H24F3NO2 — CID 56643968
2-[(E)-2-[(1S,3aS,5R,6S,7aR)-5,6-difluorospiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,2'-1,3-dioxolane]-1-yl]ethenyl]-5-(3-fluorophenyl)pyridine (PubChem CID 56643968) has the molecular formula C24H24F3NO2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-[(E)-2-[(1S,3aS,5R,6S,7aR)-5,6-difluorospiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,2'-1,3-dioxolane]-1-yl]ethenyl]-5-(3-fluorophenyl)pyridine.
| Compound Name | 2-[(E)-2-[(1S,3aS,5R,6S,7aR)-5,6-difluorospiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,2'-1,3-dioxolane]-1-yl]ethenyl]-5-(3-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 56643968 |
| Molecular Formula | C24H24F3NO2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[(E)-2-[(1S,3aS,5R,6S,7aR)-5,6-difluorospiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,2'-1,3-dioxolane]-1-yl]ethenyl]-5-(3-fluorophenyl)pyridine |
| SMILES | Fc1cccc(-c2ccc(/C=C/[C@H]3[C@@H]4C[C@H](F)[C@H](F)C[C@@H]4CC34OCCO4)nc2)c1 |
| InChI | InChI=1S/C24H24F3NO2/c25-18-3-1-2-15(10-18)16-4-5-19(28-14-16)6-7-21-20-12-23(27)22(26)11-17(20)13-24(21)29-8-9-30-24/h1-7,10,14,17,20-23H,8-9,11-13H2/b7-6+/t17-,20-,21+,22-,23+/m1/s1 |
| InChIKey | WYDOCOIVDUIJAJ-FCJLYUKUSA-N |
| XLogP | 5.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |