C27H28FNO3 — CID 70641148
(1S,2S,3R,4S,6S,9R)-2-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,4,9-trimethyl-8-oxatricyclo[4.3.3.01,6]dodecane-7,11-dione (PubChem CID 70641148) has the molecular formula C27H28FNO3 and a molecular weight of 433.52 g/mol. Its IUPAC name is (1S,2S,3R,4S,6S,9R)-2-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,4,9-trimethyl-8-oxatricyclo[4.3.3.01,6]dodecane-7,11-dione.
| Compound Name | (1S,2S,3R,4S,6S,9R)-2-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,4,9-trimethyl-8-oxatricyclo[4.3.3.01,6]dodecane-7,11-dione |
|---|---|
| PubChem CID | 70641148 |
| Molecular Formula | C27H28FNO3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (1S,2S,3R,4S,6S,9R)-2-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,4,9-trimethyl-8-oxatricyclo[4.3.3.01,6]dodecane-7,11-dione |
| SMILES | C[C@@H]1[C@@H](C)C[C@]23CC(=O)C[C@]2([C@@H](C)OC3=O)[C@H]1/C=C/c1ccc(-c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C27H28FNO3/c1-16-12-26-13-23(30)14-27(26,18(3)32-25(26)31)24(17(16)2)10-9-22-8-7-20(15-29-22)19-5-4-6-21(28)11-19/h4-11,15-18,24H,12-14H2,1-3H3/b10-9+/t16-,17+,18+,24-,26+,27-/m0/s1 |
| InChIKey | LDHIYXLDKQJRDI-CAROPIIMSA-N |
| XLogP | 5.47 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |