C24H23F3N2O2 — CID 154108792
(3'S,3'aR,7'aS)-6',6'-difluoro-3'-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3-oxazolidine-5,2'-3,3a,4,5,7,7a-hexahydro-1H-indene]-2-one (PubChem CID 154108792) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is (3'S,3'aR,7'aS)-6',6'-difluoro-3'-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3-oxazolidine-5,2'-3,3a,4,5,7,7a-hexahydro-1H-indene]-2-one.
| Compound Name | (3'S,3'aR,7'aS)-6',6'-difluoro-3'-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3-oxazolidine-5,2'-3,3a,4,5,7,7a-hexahydro-1H-indene]-2-one |
|---|---|
| PubChem CID | 154108792 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (3'S,3'aR,7'aS)-6',6'-difluoro-3'-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]spiro[1,3-oxazolidine-5,2'-3,3a,4,5,7,7a-hexahydro-1H-indene]-2-one |
| SMILES | O=C1NCC2(C[C@H]3CC(F)(F)CC[C@H]3[C@@H]2C=Cc2ccc(-c3cccc(F)c3)cn2)O1 |
| InChI | InChI=1S/C24H23F3N2O2/c25-18-3-1-2-15(10-18)16-4-5-19(28-13-16)6-7-21-20-8-9-24(26,27)12-17(20)11-23(21)14-29-22(30)31-23/h1-7,10,13,17,20-21H,8-9,11-12,14H2,(H,29,30)/t17-,20+,21-,23?/m0/s1 |
| InChIKey | MBMDOQLPLKHOFB-OAWJOKBUSA-N |
| XLogP | 5.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |