C25H28FNO3 — CID 91045628
(3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-7a-(hydroxymethyl)-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 91045628) has the molecular formula C25H28FNO3 and a molecular weight of 409.50 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-7a-(hydroxymethyl)-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-7a-(hydroxymethyl)-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 91045628 |
| Molecular Formula | C25H28FNO3 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-7a-(hydroxymethyl)-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3cccc(F)c3)cn2)[C@@H]2[C@@H](C)OC(=O)[C@]2(CO)C[C@@H]1C |
| InChI | InChI=1S/C25H28FNO3/c1-15-12-25(14-28)23(17(3)30-24(25)29)22(16(15)2)10-9-21-8-7-19(13-27-21)18-5-4-6-20(26)11-18/h4-11,13,15-17,22-23,28H,12,14H2,1-3H3/t15-,16+,17+,22-,23-,25-/m0/s1 |
| InChIKey | LSOSBGWTEDFRHK-JONBELQPSA-N |
| XLogP | 4.73 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |