C31H38FN3O3 — CID 42619208
(7aR)-7a-(4-ethylpiperazine-1-carbonyl)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 42619208) has the molecular formula C31H38FN3O3 and a molecular weight of 519.66 g/mol. Its IUPAC name is (7aR)-7a-(4-ethylpiperazine-1-carbonyl)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (7aR)-7a-(4-ethylpiperazine-1-carbonyl)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 42619208 |
| Molecular Formula | C31H38FN3O3 |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | (7aR)-7a-(4-ethylpiperazine-1-carbonyl)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | CCN1CCN(C(=O)[C@@]23CC(C)C(C)C(/C=C/c4ccc(-c5cccc(F)c5)cn4)C2C(C)OC3=O)CC1 |
| InChI | InChI=1S/C31H38FN3O3/c1-5-34-13-15-35(16-14-34)29(36)31-18-20(2)21(3)27(28(31)22(4)38-30(31)37)12-11-26-10-9-24(19-33-26)23-7-6-8-25(32)17-23/h6-12,17,19-22,27-28H,5,13-16,18H2,1-4H3/b12-11+/t20?,21?,22?,27?,28?,31-/m1/s1 |
| InChIKey | XDIYRJDCWKKXHK-UFYJPYJESA-N |
| XLogP | 4.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|