C17H18ClFN4O3 — CID 154097030
5-[1-(4-chloro-3-fluorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-N,3-dimethylpent-3-enamide (PubChem CID 154097030) has the molecular formula C17H18ClFN4O3 and a molecular weight of 380.81 g/mol. Its IUPAC name is 5-[1-(4-chloro-3-fluorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-N,3-dimethylpent-3-enamide.
| Compound Name | 5-[1-(4-chloro-3-fluorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-N,3-dimethylpent-3-enamide |
|---|---|
| PubChem CID | 154097030 |
| Molecular Formula | C17H18ClFN4O3 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-[1-(4-chloro-3-fluorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-N,3-dimethylpent-3-enamide |
| SMILES | CNC(=O)C(=NOC)C(C)=CCOc1ccn(-c2ccc(Cl)c(F)c2)n1 |
| InChI | InChI=1S/C17H18ClFN4O3/c1-11(16(22-25-3)17(24)20-2)7-9-26-15-6-8-23(21-15)12-4-5-13(18)14(19)10-12/h4-8,10H,9H2,1-3H3,(H,20,24) |
| InChIKey | DJDAHNFNSSBEDU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|