C11H6Cl3NOS — CID 154099500
3-(2,4-dichlorophenyl)-5-methyl-1,2-thiazole-4-carbonyl chloride (PubChem CID 154099500) has the molecular formula C11H6Cl3NOS and a molecular weight of 306.60 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-5-methyl-1,2-thiazole-4-carbonyl chloride.
| Compound Name | 3-(2,4-dichlorophenyl)-5-methyl-1,2-thiazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 154099500 |
| Molecular Formula | C11H6Cl3NOS |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 304.92 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-5-methyl-1,2-thiazole-4-carbonyl chloride |
| SMILES | Cc1snc(-c2ccc(Cl)cc2Cl)c1C(=O)Cl |
| InChI | InChI=1S/C11H6Cl3NOS/c1-5-9(11(14)16)10(15-17-5)7-3-2-6(12)4-8(7)13/h2-4H,1H3 |
| InChIKey | DPZRBRDSTGAGON-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|