C14H12Cl2N2O5S2 — CID 69198047
1-[4-(2,4-dichlorophenyl)-2,6-bis(methylsulfonyl)pyrimidin-5-yl]ethanone (PubChem CID 69198047) has the molecular formula C14H12Cl2N2O5S2 and a molecular weight of 423.30 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorophenyl)-2,6-bis(methylsulfonyl)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-(2,4-dichlorophenyl)-2,6-bis(methylsulfonyl)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 69198047 |
| Molecular Formula | C14H12Cl2N2O5S2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 1-[4-(2,4-dichlorophenyl)-2,6-bis(methylsulfonyl)pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2Cl)nc(S(C)(=O)=O)nc1S(C)(=O)=O |
| InChI | InChI=1S/C14H12Cl2N2O5S2/c1-7(19)11-12(9-5-4-8(15)6-10(9)16)17-14(25(3,22)23)18-13(11)24(2,20)21/h4-6H,1-3H3 |
| InChIKey | VXAURPTUBRRKHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |