C10H7Cl2N3O2S — CID 10924717
6-(2,4-dichlorophenyl)-3-methylsulfonyl-1,2,4-triazine (PubChem CID 10924717) has the molecular formula C10H7Cl2N3O2S and a molecular weight of 304.16 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-3-methylsulfonyl-1,2,4-triazine.
| Compound Name | 6-(2,4-dichlorophenyl)-3-methylsulfonyl-1,2,4-triazine |
|---|---|
| PubChem CID | 10924717 |
| Molecular Formula | C10H7Cl2N3O2S |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-3-methylsulfonyl-1,2,4-triazine |
| SMILES | CS(=O)(=O)c1ncc(-c2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C10H7Cl2N3O2S/c1-18(16,17)10-13-5-9(14-15-10)7-3-2-6(11)4-8(7)12/h2-5H,1H3 |
| InChIKey | YILKBJGKTAQYJV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |