C15H10Cl2N2OS2 — CID 1474067
4-(2,4-dichlorophenyl)-5-(4-methylphenyl)sulfinylthiadiazole (PubChem CID 1474067) has the molecular formula C15H10Cl2N2OS2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-(4-methylphenyl)sulfinylthiadiazole.
| Compound Name | 4-(2,4-dichlorophenyl)-5-(4-methylphenyl)sulfinylthiadiazole |
|---|---|
| PubChem CID | 1474067 |
| Molecular Formula | C15H10Cl2N2OS2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-(4-methylphenyl)sulfinylthiadiazole |
| SMILES | Cc1ccc(S(=O)c2snnc2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H10Cl2N2OS2/c1-9-2-5-11(6-3-9)22(20)15-14(18-19-21-15)12-7-4-10(16)8-13(12)17/h2-8H,1H3 |
| InChIKey | DLSYGANMWRUCPO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |