C20H21Cl2N3 — CID 24954864
4-(2,4-dichlorophenyl)-5-(4-methylphenyl)-2-pentyltriazole (PubChem CID 24954864) has the molecular formula C20H21Cl2N3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-(4-methylphenyl)-2-pentyltriazole.
| Compound Name | 4-(2,4-dichlorophenyl)-5-(4-methylphenyl)-2-pentyltriazole |
|---|---|
| PubChem CID | 24954864 |
| Molecular Formula | C20H21Cl2N3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-(4-methylphenyl)-2-pentyltriazole |
| SMILES | CCCCCn1nc(-c2ccc(C)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H21Cl2N3/c1-3-4-5-12-25-23-19(15-8-6-14(2)7-9-15)20(24-25)17-11-10-16(21)13-18(17)22/h6-11,13H,3-5,12H2,1-2H3 |
| InChIKey | LVQLSPABOKXLJO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|