C10H7Cl2IO — CID 154114541
1,2-dichloro-4-(1-iodoprop-2-ynoxymethyl)benzene (PubChem CID 154114541) has the molecular formula C10H7Cl2IO and a molecular weight of 340.98 g/mol. Its IUPAC name is 1,2-dichloro-4-(1-iodoprop-2-ynoxymethyl)benzene.
| Compound Name | 1,2-dichloro-4-(1-iodoprop-2-ynoxymethyl)benzene |
|---|---|
| PubChem CID | 154114541 |
| Molecular Formula | C10H7Cl2IO |
| Molecular Weight | 340.98 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 1,2-dichloro-4-(1-iodoprop-2-ynoxymethyl)benzene |
| SMILES | C#CC(I)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2IO/c1-2-10(13)14-6-7-3-4-8(11)9(12)5-7/h1,3-5,10H,6H2 |
| InChIKey | WDFYEMIPCPXBNW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|