C24H34Cl2O4 — CID 154122597
[(3S,5S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9,11-dichloro-17-hydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 154122597) has the molecular formula C24H34Cl2O4 and a molecular weight of 457.44 g/mol. Its IUPAC name is [(3S,5S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9,11-dichloro-17-hydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9,11-dichloro-17-hydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 154122597 |
| Molecular Formula | C24H34Cl2O4 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [(3S,5S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9,11-dichloro-17-hydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C=C1C[C@H]2[C@@H]3CC[C@H]4C[C@@H](OC(C)=O)CC[C@]4(C)[C@@]3(Cl)[C@@H](Cl)C[C@]2(C)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C24H34Cl2O4/c1-13-10-19-18-7-6-16-11-17(30-15(3)28)8-9-21(16,4)23(18,26)20(25)12-22(19,5)24(13,29)14(2)27/h16-20,29H,1,6-12H2,2-5H3/t16-,17-,18-,19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | FJTYLULTEGQKJH-WIKDVRPQSA-N |
| XLogP | 5.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|