C24H34ClFO5 — CID 22822147
[(3S,5R,6R,8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-5,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 22822147) has the molecular formula C24H34ClFO5 and a molecular weight of 456.98 g/mol. Its IUPAC name is [(3S,5R,6R,8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-5,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,6R,8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-5,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 22822147 |
| Molecular Formula | C24H34ClFO5 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [(3S,5R,6R,8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-5,17-dihydroxy-10,13-dimethyl-16-methylidene-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C=C1C[C@H]2[C@@H]3C[C@@H](F)[C@@]4(O)C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@@]1(O)C(=O)CCl |
| InChI | InChI=1S/C24H34ClFO5/c1-13-9-18-16-10-19(26)23(29)11-15(31-14(2)27)5-7-21(23,3)17(16)6-8-22(18,4)24(13,30)20(28)12-25/h15-19,29-30H,1,5-12H2,2-4H3/t15-,16+,17-,18-,19+,21+,22-,23-,24-/m0/s1 |
| InChIKey | QOKLXTROKMPZHP-WPUKRJHDSA-N |
| XLogP | 3.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|